cas: 135631-91-3 — see every product listed under this CAS number, including other names
6-Bromo-1,2,3,4-tetrahydro-4,4-dimethylquinoline hydrochloride, 97% (CAS 135631-91-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093242-100MG |
| cas | 135631-91-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 841.39 Pln | |
| Fluorochem | 5g | 2356.48 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline (CAS 135631-91-3) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline. InChIKey: WBOOAXJWGJAIMB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| InChIKey | WBOOAXJWGJAIMB-UHFFFAOYSA-N |
| SMILES | CC1(CCNC2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)