cas: 135631-91-3 — see every product listed under this CAS number, including other names
6-Bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline, 97%, 97% (CAS 135631-91-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118L0B-100mg |
| cas | 135631-91-3 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 870.80 Pln | |
| Chemat | 5g | 2507.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline (CAS 135631-91-3) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline. InChIKey: WBOOAXJWGJAIMB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| InChIKey | WBOOAXJWGJAIMB-UHFFFAOYSA-N |
| SMILES | CC1(CCNC2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)