6-Bromo-1H-indazole-4-carboxylic Acid, 98%
cas: 885523-08-0 — see every product listed under this CAS number, including other names
6-Bromo-1H-indazole-4-carboxylic Acid, 98% (CAS 885523-08-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114N4I-250mg |
| cas | 885523-08-0 |
| size | 250mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 1010.00 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 633.13 Pln | |
| Fluorochem | 25g | 1476.58 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-1H-indazole-4-carboxylic acid (CAS 885523-08-0) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromo-1H-indazole-4-carboxylic acid. InChIKey: YYONCBWTWPVWRT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromo-1H-indazole-4-carboxylic acid |
| InChIKey | YYONCBWTWPVWRT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)C=NN2)Br |
Computed by PubChem (NCBI)