CAS 885523-08-0 appears in our catalog under these names: 6–bromo–1H–indazole–4–carboxylic acid, 6-Bromo-1H-indazole-4-carboxylic Acid, 98%, 98%, 6-Bromo-1H-indazole-4-carboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
6-bromo-1H-indazole-4-carboxylic acid (CAS 885523-08-0) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromo-1H-indazole-4-carboxylic acid. InChIKey: YYONCBWTWPVWRT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromo-1H-indazole-4-carboxylic acid |
| InChIKey | YYONCBWTWPVWRT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)C=NN2)Br |
Computed by PubChem (NCBI)