cas: 1190861-43-8 — see every product listed under this CAS number, including other names
6-Bromo-2',3',5',6'-tetrahydrospiro[indoline-3,4'-pyran]-2-one, 97% (CAS 1190861-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F244493-100MG |
| cas | 1190861-43-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 305.12 Pln | |
| Fluorochem | 1g | 919.49 Pln | |
| Fluorochem | 2.5g | 2174.25 Pln | |
| Fluorochem | 5g | 3522.74 Pln | |
| Fluorochem | 10g | 6516.47 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 887.69 Pln | |
| Ambeed | 5g | 3457.56 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
6-bromospiro[1H-indole-3,4'-oxane]-2-one (CAS 1190861-43-8) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 6-bromospiro[1H-indole-3,4'-oxane]-2-one. InChIKey: WGDOZEMHDIATQE-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 6-bromospiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | WGDOZEMHDIATQE-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C=C(C=C3)Br)NC2=O |
Computed by PubChem (NCBI)