cas: 1807009-09-1 — see every product listed under this CAS number, including other names
6-Bromo-2,3-dichlorobenzyl alcohol (CAS 1807009-09-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631556-1G |
| cas | 1807009-09-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4590.07 Pln | |
| Fluorochem | 5g | 13628.55 Pln |
| delivery time | 3-4 weeks |
|---|
(6-bromo-2,3-dichlorophenyl)methanol (CAS 1807009-09-1) is a chemical compound with the molecular formula C7H5BrCl2O and a molecular weight of 255.92 g/mol. IUPAC name: (6-bromo-2,3-dichlorophenyl)methanol. InChIKey: ABGMWYMWAKJBLD-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2O |
|---|---|
| Molecular weight | 255.92 g/mol |
| IUPAC name | (6-bromo-2,3-dichlorophenyl)methanol |
| InChIKey | ABGMWYMWAKJBLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)Cl)CO)Br |
Computed by PubChem (NCBI)