cas: 108229-82-9 — see every product listed under this CAS number, including other names
6-Bromo-2,3-dichloroquinoxaline, 95%, 95% (CAS 108229-82-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118V6G-100mg |
| cas | 108229-82-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 2550.80 Pln | |
| Chemat | 10g | 4230.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,3-dichloroquinoxaline (CAS 108229-82-9) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,3-dichloroquinoxaline. InChIKey: PSSGUHOTRLMJNO-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,3-dichloroquinoxaline |
| InChIKey | PSSGUHOTRLMJNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)