cas: 102393-82-8 — see every product listed under this CAS number, including other names
6-Bromo-2,4-dichloroquinazoline 97% (CAS 102393-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129792-100mg |
| cas | 102393-82-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 909.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129792 |
6-bromo-2,4-dichloroquinazoline (CAS 102393-82-8) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,4-dichloroquinazoline. InChIKey: LBAYOWRVZAKPLS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,4-dichloroquinazoline |
| InChIKey | LBAYOWRVZAKPLS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)