cas: 102393-82-8 — see every product listed under this CAS number, including other names
6-Bromo-2,4-dichloroquinazoline, 95% (CAS 102393-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046226-100MG |
| cas | 102393-82-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 409.25 Pln | |
| Fluorochem | 25g | 857.01 Pln | |
| Fluorochem | 50g | 1601.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-2,4-dichloroquinazoline (CAS 102393-82-8) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,4-dichloroquinazoline. InChIKey: LBAYOWRVZAKPLS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,4-dichloroquinazoline |
| InChIKey | LBAYOWRVZAKPLS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)