cas: 102393-82-8 — see every product listed under this CAS number, including other names
6-Bromo-2,4-dichloroquinazoline, 97%, 97% (CAS 102393-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 500g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118BQ-100g |
| cas | 102393-82-8 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 250g | 3155.60 Pln | |
| Chemat | 500g | 6216.00 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1130.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,4-dichloroquinazoline (CAS 102393-82-8) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,4-dichloroquinazoline. InChIKey: LBAYOWRVZAKPLS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,4-dichloroquinazoline |
| InChIKey | LBAYOWRVZAKPLS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)