cas: 1036757-08-0 — see every product listed under this CAS number, including other names
6-Bromo-2,7-dichloroquinazoline, 98% (CAS 1036757-08-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A245292-10g |
| cas | 1036757-08-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12588.73 Pln | |
| AmBeed | 100mg | 349.93 Pln | |
| AmBeed | 5g | 7608.58 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-2,7-dichloroquinazoline (CAS 1036757-08-0) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-2,7-dichloroquinazoline. InChIKey: APEAOBLDQOPTNT-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-2,7-dichloroquinazoline |
| InChIKey | APEAOBLDQOPTNT-UHFFFAOYSA-N |
| SMILES | C1=C2C=NC(=NC2=CC(=C1Br)Cl)Cl |
Computed by PubChem (NCBI)