CAS 1060815-67-9 appears in our catalog under these names: 6-Bromo-2-chloronicotinic acid, 97%, 6-Bromo-2-chloronicotinic Acid, >95% (HPLC), 6-Bromo-2-chloronicotinic acid, 6-Bromo-2-chloronicotinic acid, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 500mg, 50mg, 0,5g, 100mg.
6-bromo-2-chloropyridine-3-carboxylic acid (CAS 1060815-67-9) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 6-bromo-2-chloropyridine-3-carboxylic acid. InChIKey: CSHIGVLXOXJJMY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 6-bromo-2-chloropyridine-3-carboxylic acid |
| InChIKey | CSHIGVLXOXJJMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)Br |
Computed by PubChem (NCBI)