cas: 1628264-05-0 — see every product listed under this CAS number, including other names
6-Bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine, ≥95%, ≥95% (CAS 1628264-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN0Y-250mg |
| cas | 1628264-05-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 100mg | 1528.40 Pln | |
| Chemat | 1g | 3842.00 Pln | |
| Chemat | 5g | 5954.00 Pln | |
| Chemat | 10g | 10058.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine (CAS 1628264-05-0) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 6-bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine. InChIKey: USFKUZLRWZPVGG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 6-bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | USFKUZLRWZPVGG-UHFFFAOYSA-N |
| SMILES | CCC1=C(N2C=C(C=CC2=N1)Br)NC |
Computed by PubChem (NCBI)