CAS 250160-26-0 is the registry number for 1-[(E)-2-(4-Bromophenyl)diazen-1-yl]pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(4-bromophenyl)-pyrrolidin-1-yldiazene (CAS 250160-26-0) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: (4-bromophenyl)-pyrrolidin-1-yldiazene. InChIKey: VNIADXHPZRPGIW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | (4-bromophenyl)-pyrrolidin-1-yldiazene |
| InChIKey | VNIADXHPZRPGIW-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)N=NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)