CAS 904813-42-9 is the registry number for 3-Bromo-2-tert-butylimidazo[1,2-a]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g.
3-bromo-2-tert-butylimidazo[1,2-a]pyrimidine (CAS 904813-42-9) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 3-bromo-2-tert-butylimidazo[1,2-a]pyrimidine. InChIKey: YFMAMTCNEVARDR-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 3-bromo-2-tert-butylimidazo[1,2-a]pyrimidine |
| InChIKey | YFMAMTCNEVARDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(N2C=CC=NC2=N1)Br |
Computed by PubChem (NCBI)