CAS 1628264-05-0 appears in our catalog under these names: 6-Bromo-2-ethyl-n-methylimidazo[1,2-a]pyridin-3-amine, 95%, 6-Bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
6-bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine (CAS 1628264-05-0) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 6-bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine. InChIKey: USFKUZLRWZPVGG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 6-bromo-2-ethyl-N-methylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | USFKUZLRWZPVGG-UHFFFAOYSA-N |
| SMILES | CCC1=C(N2C=C(C=CC2=N1)Br)NC |
Computed by PubChem (NCBI)