CAS 1612172-53-8 appears in our catalog under these names: 6-Bromo-1-isopropyl-2-methyl-1h-imidazo[4,5-c]pyridine, 95%, 1H-Imidazo(4,5-c)pyridine, 6-bromo-2-methyl-1-(1-methylethyl)-, 95%, 6-Bromo-1-isopropyl-2-methyl-1H-imidazo[4,5-c]pyridine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-bromo-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridine (CAS 1612172-53-8) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 6-bromo-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridine. InChIKey: PSXCLSJZWMAUFE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 6-bromo-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridine |
| InChIKey | PSXCLSJZWMAUFE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CN=C(C=C2N1C(C)C)Br |
Computed by PubChem (NCBI)