cas: 91659-33-5 — see every product listed under this CAS number, including other names
6-Bromo-2-fluoro-3-hydroxybenzoic acid, ≥95%, ≥95% (CAS 91659-33-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q6N-1g |
| cas | 91659-33-5 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2128.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-fluoro-3-hydroxybenzoic acid (CAS 91659-33-5) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 6-bromo-2-fluoro-3-hydroxybenzoic acid. InChIKey: LJTRQPMMGRNXFF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-hydroxybenzoic acid |
| InChIKey | LJTRQPMMGRNXFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)F)C(=O)O)Br |
Computed by PubChem (NCBI)