CAS 872696-03-2 is the registry number for 4-Bromo-2-hydrazino-1,3-benzothiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
(4-bromo-1,3-benzothiazol-2-yl)hydrazine (CAS 872696-03-2) is a chemical compound with the molecular formula C7H6BrN3S and a molecular weight of 244.11 g/mol. IUPAC name: (4-bromo-1,3-benzothiazol-2-yl)hydrazine. InChIKey: WBDWQZLAGDRYRD-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3S |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (4-bromo-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | WBDWQZLAGDRYRD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(S2)NN |
Computed by PubChem (NCBI)