CAS 1822673-45-9 is the registry number for 5-Bromo-7-methylthiazolo[5,4-b]pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-amine (CAS 1822673-45-9) is a chemical compound with the molecular formula C7H6BrN3S and a molecular weight of 244.11 g/mol. IUPAC name: 5-bromo-7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-amine. InChIKey: IMYNJTVLUPKOJG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN3S |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 5-bromo-7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| InChIKey | IMYNJTVLUPKOJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1N=C(S2)N)Br |
Computed by PubChem (NCBI)