CAS 5111-65-9 appears in our catalog under these names: Naproxen EP Impurity N, 2-Bromo-6-methoxynaphthalene (Naproxen Impurity N), >95% (HPLC), 2-Bromo-6-methoxynaphthalene, 2-Bromo-6-methoxynaphthalene/ 98.8% (existing batch purity), 6-Bromo-2-methoxynaphthalene/ 97+%. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, Chemat. Available pack sizes: on request, 10g, 1g, 50g, 25mg, 100mg, 100g, 250g.
2-bromo-6-methoxynaphthalene (CAS 5111-65-9) is a chemical compound with the molecular formula C11H9BrO and a molecular weight of 237.09 g/mol. IUPAC name: 2-bromo-6-methoxynaphthalene. InChIKey: AYFJBMBVXWNYLT-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 2-bromo-6-methoxynaphthalene |
| InChIKey | AYFJBMBVXWNYLT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)