CAS 170737-46-9 appears in our catalog under these names: 6–Bromo–2–naphthaldehyde, 6-Bromo-2-naphthaldehyde, >98.0%(GC), 2-Naphthalenecarboxaldehyde, 6-bromo-, 98%, 98%, 6-Bromo-2-naphthaldehyde, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
6-bromonaphthalene-2-carbaldehyde (CAS 170737-46-9) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 6-bromonaphthalene-2-carbaldehyde. InChIKey: DLLDUYJRQNTEOR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 6-bromonaphthalene-2-carbaldehyde |
| InChIKey | DLLDUYJRQNTEOR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1C=O |
Computed by PubChem (NCBI)