6-Bromo-2-naphthaldehyde, 98%
cas: 170737-46-9 — see every product listed under this CAS number, including other names
6-Bromo-2-naphthaldehyde, 98% (CAS 170737-46-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A730287-250mg |
| cas | 170737-46-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1271.50 Pln | |
| Ambeed | 25g | 4514.44 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 275.48 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 1363.99 Pln | |
| BLDpharm | 25g | 4862.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-bromonaphthalene-2-carbaldehyde (CAS 170737-46-9) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 6-bromonaphthalene-2-carbaldehyde. InChIKey: DLLDUYJRQNTEOR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 6-bromonaphthalene-2-carbaldehyde |
| InChIKey | DLLDUYJRQNTEOR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1C=O |
Computed by PubChem (NCBI)
