cas: 65147-89-9 — see every product listed under this CAS number, including other names
6-Bromo-2-phenyl-1H-imidazo[4,5-b]pyridine 95% (CAS 65147-89-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A793988-250mg |
| cas | 65147-89-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A793988 |
6-bromo-2-phenyl-1H-imidazo[4,5-b]pyridine (CAS 65147-89-9) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 6-bromo-2-phenyl-1H-imidazo[4,5-b]pyridine. InChIKey: UQEYLXNLWAHTFF-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 6-bromo-2-phenyl-1H-imidazo[4,5-b]pyridine |
| InChIKey | UQEYLXNLWAHTFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=N3)Br |
Computed by PubChem (NCBI)