cas: 65147-89-9 — see every product listed under this CAS number, including other names
6-Bromo-2-phenyl-1H-imidazo[4,5-b]pyridine, 95%, 95% (CAS 65147-89-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EICT-250mg |
| cas | 65147-89-9 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 933.20 Pln | |
| Chemat | 5g | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-phenyl-1H-imidazo[4,5-b]pyridine (CAS 65147-89-9) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 6-bromo-2-phenyl-1H-imidazo[4,5-b]pyridine. InChIKey: UQEYLXNLWAHTFF-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 6-bromo-2-phenyl-1H-imidazo[4,5-b]pyridine |
| InChIKey | UQEYLXNLWAHTFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=N3)Br |
Computed by PubChem (NCBI)