cas: 2065250-59-9 — see every product listed under this CAS number, including other names
6-Bromo-3,4-dichlorocinnoline, 95% (CAS 2065250-59-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A759221-1g |
| cas | 2065250-59-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8448.37 Pln | |
| AmBeed | 5g | 28928.83 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-3,4-dichlorocinnoline (CAS 2065250-59-9) is a chemical compound with the molecular formula C8H3BrCl2N2 and a molecular weight of 277.93 g/mol. IUPAC name: 6-bromo-3,4-dichlorocinnoline. InChIKey: CZTGSVQKAZFWAV-UHFFFAOYSA-N.
| Molecular formula | C8H3BrCl2N2 |
|---|---|
| Molecular weight | 277.93 g/mol |
| IUPAC name | 6-bromo-3,4-dichlorocinnoline |
| InChIKey | CZTGSVQKAZFWAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=C(N=N2)Cl)Cl |
Computed by PubChem (NCBI)