cas: 66361-67-9 — see every product listed under this CAS number, including other names
6-Bromo-3,4-dihydro-1(2H)-naphthalenone, 99.47% (CAS 66361-67-9) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 500 mg, 10 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008321-1 g |
| cas | 66361-67-9 |
| size | 1 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 324.34 Pln | |
| MedChemExpress | 5 g | 742.30 Pln | |
| MedChemExpress | 500 mg | 254.68 Pln | |
| MedChemExpress | 10 g | 1058.09 Pln | |
| MedChemExpress | 10mM/1mL | 263.96 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.47% |
6-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 66361-67-9) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: OSDHOOBPMBLALZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | OSDHOOBPMBLALZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(=O)C1 |
Computed by PubChem (NCBI)