cas: 66361-67-9 — see every product listed under this CAS number, including other names
6-Bromotetral-1-one, 97% (CAS 66361-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077366-100MG |
| cas | 66361-67-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 10g | 1039.24 Pln | |
| Fluorochem | 25g | 2127.39 Pln | |
| Fluorochem | 100g | 6797.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 66361-67-9) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: OSDHOOBPMBLALZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | OSDHOOBPMBLALZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(=O)C1 |
Computed by PubChem (NCBI)