cas: 66361-67-9 — see every product listed under this CAS number, including other names
6-Bromo-1-tetralone, >95.0%(GC) (CAS 66361-67-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4841-1G |
| cas | 66361-67-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 492.06 Pln | |
| TCI | 5g | 1637.78 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
6-bromo-3,4-dihydro-2H-naphthalen-1-one (CAS 66361-67-9) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-3,4-dihydro-2H-naphthalen-1-one. InChIKey: OSDHOOBPMBLALZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | OSDHOOBPMBLALZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(=O)C1 |
Computed by PubChem (NCBI)