cas: 21440-97-1 — see every product listed under this CAS number, including other names
6-Bromo-4,4-dimethyl-1,4-dihydrobenzo[d][1,3]oxazin-2-one, 98% (CAS 21440-97-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077842-250MG |
| cas | 21440-97-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 1002.79 Pln | |
| Fluorochem | 5g | 2845.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 21440-97-1) is a chemical compound with the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. IUPAC name: 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: JRXGULDSFFLUAO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO2 |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 6-bromo-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | JRXGULDSFFLUAO-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)NC(=O)O1)C |
Computed by PubChem (NCBI)