cas: 139515-86-9 — see every product listed under this CAS number, including other names
6-Bromo-4-nitro-2,3-dihydro-1H-inden-5-ol 97% (CAS 139515-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A195614-100mg |
| cas | 139515-86-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 676.31 Pln | |
| Ambeed | 1g | 1382.75 Pln | |
| Ambeed | 5g | 3802.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A195614 |
6-bromo-4-nitro-2,3-dihydro-1H-inden-5-ol (CAS 139515-86-9) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 6-bromo-4-nitro-2,3-dihydro-1H-inden-5-ol. InChIKey: UFMMRKGHDCFWAB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 6-bromo-4-nitro-2,3-dihydro-1H-inden-5-ol |
| InChIKey | UFMMRKGHDCFWAB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C(=C2C1)[N+](=O)[O-])O)Br |
Computed by PubChem (NCBI)