CAS 98203-04-4 appears in our catalog under these names: 6-Bromo-5-Nitroquinoline, 97%, 97%, 6-Bromo-5-nitroquinoline, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
6-bromo-5-nitroquinoline (CAS 98203-04-4) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 6-bromo-5-nitroquinoline. InChIKey: ISBMTVQQECNRQY-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 6-bromo-5-nitroquinoline |
| InChIKey | ISBMTVQQECNRQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2[N+](=O)[O-])Br)N=C1 |
Computed by PubChem (NCBI)