CAS 1336963-95-1 appears in our catalog under these names: 6-Bromo-7-fluoroindoline-2,3-dione, 6-bromo-7-fluoroisatin, 97%, 97%, 6-BROMO-7-FLUOROINDOLINE-2,3-DIONE, 93%, 6-Bromo-7-fluoroindoline-2,3-dione, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
6-bromo-7-fluoro-1H-indole-2,3-dione (CAS 1336963-95-1) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 6-bromo-7-fluoro-1H-indole-2,3-dione. InChIKey: GVZVXBNHVMAAAK-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 6-bromo-7-fluoro-1H-indole-2,3-dione |
| InChIKey | GVZVXBNHVMAAAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)Br |
Computed by PubChem (NCBI)