cas: 943995-18-4 — see every product listed under this CAS number, including other names
6-Bromo-8-methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one 98% (CAS 943995-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A579671-100mg |
| cas | 943995-18-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 848.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A579671 |
6-bromo-8-methoxy-4H-1,4-benzoxazin-3-one (CAS 943995-18-4) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 6-bromo-8-methoxy-4H-1,4-benzoxazin-3-one. InChIKey: MIXOICKBNDQVQQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 6-bromo-8-methoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | MIXOICKBNDQVQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1OCC(=O)N2)Br |
Computed by PubChem (NCBI)