CAS 127446-42-8 appears in our catalog under these names: 6-Chloro-1,8-naphthyridin-2(1H)-one, 98%, 98%, 6-Chloro-1,8-naphthyridin-2(1H)-one, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-chloro-1H-1,8-naphthyridin-2-one (CAS 127446-42-8) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 6-chloro-1H-1,8-naphthyridin-2-one. InChIKey: IYWRHKRVRGDEMY-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 6-chloro-1H-1,8-naphthyridin-2-one |
| InChIKey | IYWRHKRVRGDEMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=NC=C(C=C21)Cl |
Computed by PubChem (NCBI)