cas: 73051-44-2 — see every product listed under this CAS number, including other names
6-Chloro-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 97%, 97% (CAS 73051-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116N2C-250mg |
| cas | 73051-44-2 |
| size | 250mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 194.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 73051-44-2) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 6-chloro-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: DJBHURPHBJCVAN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 6-chloro-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | DJBHURPHBJCVAN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)Cl)N |
Computed by PubChem (NCBI)