Products 1806784-37-1

CAS 1806784-37-1 is the registry number for 5-Chloro-6-(difluoromethyl)nicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-chloro-6-(difluoromethyl)pyridine-3-carboxylic acid (CAS 1806784-37-1) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 5-chloro-6-(difluoromethyl)pyridine-3-carboxylic acid. InChIKey: XCQPICPQMPXJPD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClF2NO2
Molecular weight207.56 g/mol
IUPAC name5-chloro-6-(difluoromethyl)pyridine-3-carboxylic acid
InChIKeyXCQPICPQMPXJPD-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)C(F)F)C(=O)O

Computed by PubChem (NCBI)