CAS 627527-11-1 is the registry number for 1-Chloro-2-(difluoromethyl)-4-nitrobenzene, 95+%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g, 25g.
1-chloro-2-(difluoromethyl)-4-nitrobenzene (CAS 627527-11-1) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 1-chloro-2-(difluoromethyl)-4-nitrobenzene. InChIKey: AZXIMSLYUJZLJH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 1-chloro-2-(difluoromethyl)-4-nitrobenzene |
| InChIKey | AZXIMSLYUJZLJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)F)Cl |
Computed by PubChem (NCBI)