Products 1256794-46-3
CAS 1256794-46-3 appears in our catalog under these names: 5-Chloro-2-(difluoromethyl)pyridine-3-carboxylic acid, 95%, 5-Chloro-2-(difluoromethyl)nicotinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 500mg, 1g, 250mg.
5-chloro-2-(difluoromethyl)pyridine-3-carboxylic acid (CAS 1256794-46-3) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 5-chloro-2-(difluoromethyl)pyridine-3-carboxylic acid. InChIKey: SAGNXMZHTBLRID-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 5-chloro-2-(difluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | SAGNXMZHTBLRID-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(F)F)Cl |
Computed by PubChem (NCBI)