CAS 73051-44-2 appears in our catalog under these names: 5-Amino-6-Chloro-2,2-difluorobenzodioxole, 97%, 6-Chloro-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 97%, 97%, 6-Chloro-2,2-difluoro-benzo[1,3]dioxol-5-ylamine, 97%, 6-Chloro-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
6-chloro-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 73051-44-2) is a chemical compound with the molecular formula C7H4ClF2NO2 and a molecular weight of 207.56 g/mol. IUPAC name: 6-chloro-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: DJBHURPHBJCVAN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2NO2 |
|---|---|
| Molecular weight | 207.56 g/mol |
| IUPAC name | 6-chloro-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | DJBHURPHBJCVAN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)Cl)N |
Computed by PubChem (NCBI)