cas: 1436866-79-3 — see every product listed under this CAS number, including other names
6-Chloro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 1436866-79-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQH2-1g |
| cas | 1436866-79-3 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 587.60 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 5g | 2157.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1436866-79-3) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 6-chloro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YAHADHKIILPLKC-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 6-chloro-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YAHADHKIILPLKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)Cl)C |
Computed by PubChem (NCBI)