6-Chloro-2H-chromen-2-one, 95%
cas: 2051-59-4 — see every product listed under this CAS number, including other names
6-Chloro-2H-chromen-2-one, 95% (CAS 2051-59-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A889875-250mg |
| cas | 2051-59-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 431.56 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Ambeed | 5g | 3874.75 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 957.20 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 458.75 Pln | |
| BLDpharm | 1g | 1069.65 Pln | |
| BLDpharm | 5g | 4174.11 Pln | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 763.29 Pln | |
| Fluorochem | 1g | 1762.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-chlorochromen-2-one (CAS 2051-59-4) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 6-chlorochromen-2-one. InChIKey: AMQSYJCKXPUEDR-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 6-chlorochromen-2-one |
| InChIKey | AMQSYJCKXPUEDR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1Cl |
Computed by PubChem (NCBI)