CAS 1359703-79-9 appears in our catalog under these names: 6-Chloro-3H-spiro[isobenzofuran-1,4'-piperidine] hydrochloride, 97%, 97%, 6-Chloro-3H-spiro[isobenzofuran-1,4'-piperidine] hydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride (CAS 1359703-79-9) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 5-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: ZFJLJHHYHNRPEY-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 5-chlorospiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | ZFJLJHHYHNRPEY-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(CO2)C=CC(=C3)Cl.Cl |
Computed by PubChem (NCBI)