cas: 33533-99-2 — see every product listed under this CAS number, including other names
6-Chloro-4H-chromen-4-one, 98%, 98% (CAS 33533-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXNG-1g |
| cas | 33533-99-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chlorochromen-4-one (CAS 33533-99-2) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 6-chlorochromen-4-one. InChIKey: VFZQATFTQAZCMO-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 6-chlorochromen-4-one |
| InChIKey | VFZQATFTQAZCMO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C=CO2 |
Computed by PubChem (NCBI)