CAS 1601170-14-2 appears in our catalog under these names: 6-Chloro-7-fluoro-quinoline-2-carboxylic acid, 95%, 6-chloro-7-fluoro-quinoline-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.
6-chloro-7-fluoroquinoline-2-carboxylic acid (CAS 1601170-14-2) is a chemical compound with the molecular formula C10H5ClFNO2 and a molecular weight of 225.60 g/mol. IUPAC name: 6-chloro-7-fluoroquinoline-2-carboxylic acid. InChIKey: SEEYEOWRFAHCDM-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 6-chloro-7-fluoroquinoline-2-carboxylic acid |
| InChIKey | SEEYEOWRFAHCDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=CC(=C(C=C21)Cl)F)C(=O)O |
Computed by PubChem (NCBI)