CAS 1188228-73-0 is the registry number for 5-Chloro-3-(4-fluorophenyl)isoxazole-4-carbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(4-fluorophenyl)-1,2-oxazole-4-carbaldehyde (CAS 1188228-73-0) is a chemical compound with the molecular formula C10H5ClFNO2 and a molecular weight of 225.60 g/mol. IUPAC name: 5-chloro-3-(4-fluorophenyl)-1,2-oxazole-4-carbaldehyde. InChIKey: LBUHJDJXBDRJAW-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 5-chloro-3-(4-fluorophenyl)-1,2-oxazole-4-carbaldehyde |
| InChIKey | LBUHJDJXBDRJAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2C=O)Cl)F |
Computed by PubChem (NCBI)