Products 2757096-67-4
CAS 2757096-67-4 is the registry number for 1-Chloro-2-fluoro-5-nitronaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-fluoro-5-nitronaphthalene (CAS 2757096-67-4) is a chemical compound with the molecular formula C10H5ClFNO2 and a molecular weight of 225.60 g/mol. IUPAC name: 1-chloro-2-fluoro-5-nitronaphthalene. InChIKey: VOECCOOYSSMYMA-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 1-chloro-2-fluoro-5-nitronaphthalene |
| InChIKey | VOECCOOYSSMYMA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2Cl)F)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)