CAS 134220-37-4 appears in our catalog under these names: 1-(3-Chloro-4-fluorophenyl)-1h-pyrrole-2,5-dione, 95%, 1-(3-Chloro-4-Fluorophenyl)-1H-Pyrrole-2,5-Dione, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 25g.
1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione (CAS 134220-37-4) is a chemical compound with the molecular formula C10H5ClFNO2 and a molecular weight of 225.60 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione. InChIKey: MALVOABWAGKNIK-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | MALVOABWAGKNIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C=CC2=O)Cl)F |
Computed by PubChem (NCBI)