CAS 902742-88-5 is the registry number for 2-Quinolinecarboxylic acid, 4-chloro-6-fluoro-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-chloro-6-fluoroquinoline-2-carboxylic acid (CAS 902742-88-5) is a chemical compound with the molecular formula C10H5ClFNO2 and a molecular weight of 225.60 g/mol. IUPAC name: 4-chloro-6-fluoroquinoline-2-carboxylic acid. InChIKey: NKWCQHUSWMEVHN-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 4-chloro-6-fluoroquinoline-2-carboxylic acid |
| InChIKey | NKWCQHUSWMEVHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=CC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)