cas: 21921-70-0 — see every product listed under this CAS number, including other names
6-Chloroquinolin-4(1H)-one, 95+% (CAS 21921-70-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A612528-10g |
| cas | 21921-70-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 877.24 Pln | |
| AmBeed | 5g | 538.72 Pln | |
| AmBeed | 1g | 232.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-1H-quinolin-4-one (CAS 21921-70-0) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 6-chloro-1H-quinolin-4-one. InChIKey: XXGUQCVVGPZTPF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 6-chloro-1H-quinolin-4-one |
| InChIKey | XXGUQCVVGPZTPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C=CN2 |
Computed by PubChem (NCBI)