cas: 612-57-7 — see every product listed under this CAS number, including other names
6-Chloroquinoline, 98% (CAS 612-57-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F049700-5G |
| cas | 612-57-7 |
| size | 5g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 100g | 529.00 Pln | |
| Fluorochem | 500g | 2111.77 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 520.56 Pln | |
| Ambeed | 500g | 2128.12 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
6-chloroquinoline (CAS 612-57-7) is a chemical compound with the molecular formula C9H6ClN and a molecular weight of 163.60 g/mol. IUPAC name: 6-chloroquinoline. InChIKey: GKJSZXGYFJBYRQ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN |
|---|---|
| Molecular weight | 163.60 g/mol |
| IUPAC name | 6-chloroquinoline |
| InChIKey | GKJSZXGYFJBYRQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)N=C1 |
Computed by PubChem (NCBI)